For research use only. Not for therapeutic Use.
Ascr#18（Cat No.:I044813）is a small-molecule ascaroside, part of a class of pheromones used by Caenorhabditis elegans and related nematodes to regulate social behavior, development, and lifespan. Structurally, it consists of a dideoxysugar linked to a fatty acid-like side chain, with Ascr#18 distinguished by specific hydroxylation patterns. Functionally, it acts as a signaling cue involved in dauer formation—a stress-resistant larval stage—helping nematodes adapt to environmental conditions. Ascr#18 also plays roles in population density sensing and mating behaviors, making it a valuable tool for studying chemical communication and metabolic regulation in nematode biology.
| CAS Number | 1355681-10-5 |
| Synonyms | (10R)-10-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxyundecanoic acid |
| Molecular Formula | C17H32O6 |
| Purity | ≥95% |
| IUPAC Name | (10R)-10-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxyundecanoic acid |
| InChI | InChI=1S/C17H32O6/c1-12(9-7-5-3-4-6-8-10-16(20)21)22-17-15(19)11-14(18)13(2)23-17/h12-15,17-19H,3-11H2,1-2H3,(H,20,21)/t12-,13+,14-,15-,17-/m1/s1 |
| InChIKey | AHRWSOYISAIFOZ-JRBZFYFNSA-N |
| SMILES | C[C@H]1[C@@H](C[C@H]([C@@H](O1)O[C@H](C)CCCCCCCCC(=O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
