For research use only. Not for therapeutic Use.
Asatone（Cat No.:I018399）is a naturally occurring acetophenone derivative first identified in Asarum species and other medicinal plants. Structurally characterized by its phenolic ketone group, it exhibits notable biological activities relevant to pharmacological research. Studies suggest that Asatone possesses anti-inflammatory, antimicrobial, and cytotoxic properties, with potential applications in cancer and infection-related investigations. Its activity is often linked to modulation of oxidative stress and cellular signaling pathways. Asatone’s defined structure and multifunctional profile make it a valuable compound for natural product research and biomedical studies.
| CAS Number | 38451-63-7 |
| Synonyms | (1S,2S,7S,8R)-3,3,5,8,10,10-hexamethoxy-7,11-bis(prop-2-enyl)tricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
| Molecular Formula | C24H32O8 |
| Purity | ≥95% |
| IUPAC Name | 3,3,5,8,10,10-hexamethoxy-7,11-bis(prop-2-enyl)tricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
| InChI | InChI=1S/C24H32O8/c1-9-11-15-13-22(28-4)20(26)23(29-5,30-6)17(15)18-21(22,12-10-2)14-16(27-3)19(25)24(18,31-7)32-8/h9-10,13-14,17-18H,1-2,11-12H2,3-8H3 |
| InChIKey | XBKKBTPYPCCCKA-UHFFFAOYSA-N |
| SMILES | COC1=CC2(C(C3C(=CC2(C(=O)C3(OC)OC)OC)CC=C)C(C1=O)(OC)OC)CC=C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
