AS1517499 - CAS 919486-40-1
AS1517499(CAT: I005481) is a chemical compound known as a potent inhibitor of STAT6 (Signal Transducer and Activator of Transcription 6). STAT6 is a transcription factor involved in the signaling pathway of certain immune cells, particularly those involved in allergic and inflammatory responses. By inhibiting STAT6, AS1517499 may modulate the activity of these immune cells and potentially impact allergic and inflammatory conditions.
Catalog Number: I005481
CAS Number: 919486-40-1
PubChem Substance ID:355036724
Molecular Formula: C20H20ClN5O2
Molecular Weight:397.86
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Synonym
Synonyms | AS-1517499 |
---|
Property
Molecular Formula: | C20H20ClN5O2 |
---|---|
Molecular Weight | 397.86 |
Target: | STAT6 |
Solubility | DMSO: ≥ 35 mg/mL |
Purity | ≥95% |
Storage | Desiccate at +4C |
IC50 | 21 nM (STAT6) |
Computed Descriptor
InChI | InChI=1S/C20H20ClN5O2/c21-16-10-13(6-7-17(16)27)8-9-23-20-25-12-15(18(22)28)19(26-20)24-11-14-4-2-1-3-5-14/h1-7,10,12,27H,8-9,11H2,(H2,22,28)(H2,23,24,25,26) |
---|---|
InChIKey | OZRMEKAUZBKTTC-UHFFFAOYSA-N |
SMILES | c1ccc(cc1)CNc2c(cnc(n2)NCCc3ccc(c(c3)Cl)O)C(=O)N |