For research use only. Not for therapeutic Use.
ARP101（Cat No.:I002790）is a selective, potent inhibitor of matrix metalloproteinase-2 (MMP-2), a critical enzyme involved in extracellular matrix remodeling, tumor invasion, angiogenesis, and metastasis. By specifically targeting MMP-2, ARP101 effectively reduces cellular invasion, migration, and proliferation, making it valuable for research into cancer progression and metastasis. Additionally, its selectivity minimizes off-target effects, ensuring reliable experimental outcomes. ARP101 serves as a crucial tool for scientists investigating tumor biology, extracellular matrix dynamics, and therapeutic strategies aimed at inhibiting pathological tissue remodeling associated with cancers and other invasive diseases.
| CAS Number | 849773-63-3 |
| Synonyms | (2R)-N-hydroxy-3-methyl-2-[(4-phenylphenyl)sulfonyl-propan-2-yloxyamino]butanamide |
| Molecular Formula | C20H26N2O5S |
| Purity | ≥95% |
| IUPAC Name | (2R)-N-hydroxy-3-methyl-2-[(4-phenylphenyl)sulfonyl-propan-2-yloxyamino]butanamide |
| InChI | InChI=1S/C20H26N2O5S/c1-14(2)19(20(23)21-24)22(27-15(3)4)28(25,26)18-12-10-17(11-13-18)16-8-6-5-7-9-16/h5-15,19,24H,1-4H3,(H,21,23)/t19-/m1/s1 |
| InChIKey | DGZZVIWCMGVHGV-LJQANCHMSA-N |
| SMILES | CC(C)[C@H](C(=O)NO)N(OC(C)C)S(=O)(=O)C1=CC=C(C=C1)C2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
