For research use only. Not for therapeutic Use.
ARN5187 trihydrochloride(Cat No.:I002775)is a small molecule inhibitor designed to target specific protein kinases involved in cancer cell proliferation and survival. It acts by inhibiting key enzymes in signaling pathways that regulate cell growth and resistance to apoptosis. ARN5187 trihydrochloride has shown promise in preclinical studies, particularly for targeting cancers with aberrant kinase activity, including certain types of leukemia and solid tumors. Its selective action allows for reduced off-target effects, offering a potential therapeutic strategy to improve cancer treatment outcomes and overcome resistance to conventional therapies.
CAS Number | 1700693-96-4 |
Synonyms | 4-[[[1-(2-fluorophenyl)cyclopentyl]amino]methyl]-2-[(4-methylpiperazin-1-yl)methyl]phenol;trihydrochloride |
Molecular Formula | C24H35Cl3FN3O |
Purity | ≥95% |
IUPAC Name | 4-[[[1-(2-fluorophenyl)cyclopentyl]amino]methyl]-2-[(4-methylpiperazin-1-yl)methyl]phenol;trihydrochloride |
InChI | InChI=1S/C24H32FN3O.3ClH/c1-27-12-14-28(15-13-27)18-20-16-19(8-9-23(20)29)17-26-24(10-4-5-11-24)21-6-2-3-7-22(21)25;;;/h2-3,6-9,16,26,29H,4-5,10-15,17-18H2,1H3;3*1H |
InChIKey | DCJGIMILIULIAL-UHFFFAOYSA-N |
SMILES | CN1CCN(CC1)CC2=C(C=CC(=C2)CNC3(CCCC3)C4=CC=CC=C4F)O.Cl.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |