For research use only. Not for therapeutic Use.
Aripiprazole(CAT: A000519) is an atypical antipsychotic drug (C₂₃H₂₇Cl₂N₃O₂) used to treat schizophrenia, bipolar disorder, major depressive disorder (as an adjunct), and irritability associated with autism spectrum disorder. It acts as a partial agonist at dopamine D₂ and serotonin 5-HT₁A receptors, and as an antagonist at serotonin 5-HT₂A receptors, helping to balance neurotransmitter activity in the brain. This unique mechanism—termed a “dopamine-serotonin system stabilizer”—reduces psychotic symptoms while minimizing some side effects associated with older antipsychotics.
| CAS Number | 129722-12-9 |
| Synonyms | 129722-12-9; Abilify; Abilitat; Abilify Discmelt; OPC-14597 |
| Molecular Formula | C₂₃H₂₇Cl₂N₃O₂ |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | -20°C |
| IUPAC Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
| InChI | InChI=1S/C23H27Cl2N3O2/c24-19-4-3-5-21(23(19)25)28-13-11-27(12-14-28)10-1-2-15-30-18-8-6-17-7-9-22(29)26-20(17)16-18/h3-6,8,16H,1-2,7,9-15H2,(H,26,29) |
| InChIKey | CEUORZQYGODEFX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC2=C1C=CC(=C2)OCCCCN3CCN(CC3)C4=C(C(=CC=C4)Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
