For research use only. Not for therapeutic Use.
Arecaidine（Cat No.:I044956）is a naturally occurring alkaloid primarily found in the areca nut (Areca catechu), often consumed in betel quid. It is a metabolite of arecoline and exhibits various pharmacological effects, including stimulation of the central nervous system, muscle contraction, and modulation of neurotransmitter release. Arecaidine functions as a GABA uptake inhibitor and can affect cholinergic and dopaminergic signaling pathways. While it has potential therapeutic applications in neurology, chronic exposure has been linked to adverse effects such as oral submucous fibrosis and carcinogenesis, making it a compound of both scientific and toxicological interest.
| CAS Number | 499-04-7 |
| Synonyms | 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylic acid |
| Molecular Formula | C7H11NO2 |
| Purity | ≥95% |
| IUPAC Name | 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylic acid |
| InChI | InChI=1S/C7H11NO2/c1-8-4-2-3-6(5-8)7(9)10/h3H,2,4-5H2,1H3,(H,9,10) |
| InChIKey | DNJFTXKSFAMXQF-UHFFFAOYSA-N |
| SMILES | CN1CCC=C(C1)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
