1. Home
  2. Product
  3. Catalysts and Ligands
  4. Chiral phosphine ligands
  5. (aR)-(1,2,3,4-Tetrahydroquinoline-1-yl)phosphonous acid 1,1'-binaphthalene-2,2'-diyl ester

(aR)-(1,2,3,4-Tetrahydroquinoline-1-yl)phosphonous acid 1,1'-binaphthalene-2,2'-diyl ester - CAS 1710694-47-5

(aR)-(1,2,3,4-Tetrahydroquinoline-1-yl)phosphonous acid 1,1′-binaphthalene-2,2′-diyl ester (Cat.No:L003412) is a notable compound in organic synthesis. Its chiral structure, featuring a phosphonous acid group, plays a crucial role in asymmetric catalysis. This compound serves as a valuable building block for the creation of specialized molecules with potential applications in pharmaceuticals and agrochemicals, showcasing its significance in contemporary chemical research.

Catalog Number: L003412

CAS Number: 1710694-47-5

Molecular Formula: C29H22NO2P

Molecular Weight:447.5

Purity: ≥95%

Online inquiry

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C29H22NO2P
Molecular Weight447.5
Purity≥95%

Computed Descriptor

IUPAC Name1-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)-3,4-dihydro-2H-quinoline
InChIInChI=1S/C29H22NO2P/c1-4-12-23-20(8-1)15-17-26-28(23)29-24-13-5-2-9-21(24)16-18-27(29)32-33(31-26)30-19-7-11-22-10-3-6-14-25(22)30/h1-6,8-10,12-18H,7,11,19H2
InChIKeyYQTDEFANHFXFGX-UHFFFAOYSA-N
SMILESC1CC2=CC=CC=C2N(C1)P3OC4=C(C5=CC=CC=C5C=C4)C6=C(O3)C=CC7=CC=CC=C76