For research use only. Not for therapeutic Use.
APN-C3-PEG4-azide（Cat No.:I015778）is a heterobifunctional reagent designed for advanced bioconjugation and chemical biology applications. It features an APN (aminopropionitrile-derived) group linked via a C3 spacer, providing stability and functional versatility, and a terminal azide group for bioorthogonal click chemistry with alkyne partners. The PEG4 spacer enhances hydrophilicity, flexibility, and solubility while reducing steric hindrance, ensuring efficient reactivity in both aqueous and organic media. This reagent is valuable for probe synthesis, targeted drug delivery, surface modification, and proteomics, enabling precise and modular molecular assembly in complex biological systems.
| CAS Number | 2183440-32-4 |
| Synonyms | 4-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]-N-[4-(2-cyanoethynyl)phenyl]butanamide |
| Molecular Formula | C24H32N6O6 |
| Purity | ≥95% |
| IUPAC Name | 4-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]-N-[4-(2-cyanoethynyl)phenyl]butanamide |
| InChI | InChI=1S/C24H32N6O6/c25-10-1-3-21-5-7-22(8-6-21)29-24(32)4-2-11-27-23(31)9-13-33-15-17-35-19-20-36-18-16-34-14-12-28-30-26/h5-8H,2,4,9,11-20H2,(H,27,31)(H,29,32) |
| InChIKey | JKVJRGOKGCBEJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC#N)NC(=O)CCCNC(=O)CCOCCOCCOCCOCCN=[N+]=[N-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
