The biology of highly reactive oxygen radical species is of great interest in many biomedical research disciplines, including, neurodegeneration and aging, cancer, and infectious diseases. There are a number of fluorescent reagents that can be used to detect free radicals, such as 2,7-<wbr></wbr>dichlorodihydrofluorescein (DCDHF), but they have significant limitations due to their facile oxidation by light and numerous non-<wbr></wbr>radical oxidants such as hydrogen peroxide (H<sub>2</sub>O<sub>2</sub>). APF is an aromatic amino-<wbr></wbr>fluorescein derivative that has little intrinsic fluorescence. It undergoes oxidation only by the hydroxyl radical, hypochlorite ion, and certain peroxidase intermediates, but is inert to NO, H<sub>2</sub>O<sub>2</sub>, superoxide, and other oxidants. Upon oxidation, APF is converted to the highly fluorescent molecule fluorescein, allowing the simple direct detection of highly reactive biological radicals.
Catalog Number | R042748 |
CAS Number | 359010-70-1 |
Synonyms | 2-[6-(4-aminophenoxy)-3-oxo-3H-xanthen-9-yl]-benzoic acid |
Molecular Formula | C26H17NO5 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 2-[3-(4-aminophenoxy)-6-oxoxanthen-9-yl]benzoic acid |
InChI | InChI=1S/C26H17NO5/c27-15-5-8-17(9-6-15)31-18-10-12-22-24(14-18)32-23-13-16(28)7-11-21(23)25(22)19-3-1-2-4-20(19)26(29)30/h1-14H,27H2,(H,29,30) |
InChIKey | GIERQYKZWFLVGR-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C2=C3C=CC(=O)C=C3OC4=C2C=CC(=C4)OC5=CC=C(C=C5)N)C(=O)O |
Reference | 1.Matés, J.M.,Pèrez-Gómez, C., and Nuñez de Castro, I. Antioxidant enzymes and human diseases. Clinical Biochemistry 32(8), 595-603 (1999). |