For research use only. Not for therapeutic Use.
AP-C5（Cat No.:I014788）is a small-molecule inhibitor designed to selectively block complement component C5, a key protein in the terminal pathway of the complement system. By preventing C5 cleavage into C5a and C5b, AP-C5 inhibits formation of the membrane attack complex (MAC) and reduces pro-inflammatory signaling. This makes it a valuable tool for studying immune regulation, inflammatory responses, and complement-driven pathologies. Researchers apply AP-C5 in models of autoimmune disease, neuromuscular disorders, and rare complement-mediated conditions, providing insights into therapeutic strategies targeting complement activation and immune-mediated tissue damage.
| CAS Number | 2234272-10-5 |
| Synonyms | 4-(4-imidazol-1-ylphenyl)-N-prop-2-ynylpyrimidin-2-amine |
| Molecular Formula | C16H13N5 |
| Purity | ≥95% |
| IUPAC Name | 4-(4-imidazol-1-ylphenyl)-N-prop-2-ynylpyrimidin-2-amine |
| InChI | InChI=1S/C16H13N5/c1-2-8-18-16-19-9-7-15(20-16)13-3-5-14(6-4-13)21-11-10-17-12-21/h1,3-7,9-12H,8H2,(H,18,19,20) |
| InChIKey | QKHQFSQJQKGFAA-UHFFFAOYSA-N |
| SMILES | C#CCNC1=NC=CC(=N1)C2=CC=C(C=C2)N3C=CN=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
