For research use only. Not for therapeutic Use.
Antiproliferative Agent-37(CAT: I040570) is a novel small molecule designed to inhibit abnormal cell growth in cancer models. It interferes with key signaling pathways involved in cell cycle progression, apoptosis regulation, or DNA synthesis, resulting in effective suppression of tumor cell proliferation. Demonstrating potent cytotoxicity in various cancer cell lines, Agent-37 is suitable for mechanistic studies and high-throughput screening applications. Its selectivity profile supports research into targeted cancer therapies with reduced toxicity to normal cells. Ideal for in vitro and in vivo investigations, Antiproliferative Agent-37 is a valuable tool for oncology drug discovery and preclinical development.
| CAS Number | 2989275-31-0 |
| Synonyms | 7-(2,4-dimethoxyphenyl)-3-(3-fluorophenyl)-1H-pyrrolo[2,3-c]pyridine |
| Molecular Formula | C21H17FN2O2 |
| Purity | ≥95% |
| IUPAC Name | 7-(2,4-dimethoxyphenyl)-3-(3-fluorophenyl)-1H-pyrrolo[2,3-c]pyridine |
| InChI | InChI=1S/C21H17FN2O2/c1-25-15-6-7-17(19(11-15)26-2)21-20-16(8-9-23-21)18(12-24-20)13-4-3-5-14(22)10-13/h3-12,24H,1-2H3 |
| InChIKey | GFGUONALQQRUOT-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=NC=CC3=C2NC=C3C4=CC(=CC=C4)F)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
