For research use only. Not for therapeutic Use.
Antiproliferative Agent-36(CAT: I040673) is a synthetic small molecule designed to inhibit the growth and proliferation of cancer cells by targeting key pathways involved in cell cycle regulation and survival. Though the exact molecular target may vary, Agent-36 is commonly used in oncology research to explore mechanisms of cytotoxicity, apoptosis induction, and cell cycle arrest in a range of tumor models. Its potent antiproliferative effects make it a valuable compound for structure-activity relationship (SAR) studies and preclinical drug development. Antiproliferative Agent-36 supports the identification of novel therapeutic strategies for aggressive and treatment-resistant cancers.
| CAS Number | 193828-76-1 |
| Synonyms | N-[(E)-1-pyrimidin-4-ylethylideneamino]-1,3-benzothiazol-2-amine |
| Molecular Formula | C13H11N5S |
| Purity | ≥95% |
| IUPAC Name | N-[(E)-1-pyrimidin-4-ylethylideneamino]-1,3-benzothiazol-2-amine |
| InChI | InChI=1S/C13H11N5S/c1-9(10-6-7-14-8-15-10)17-18-13-16-11-4-2-3-5-12(11)19-13/h2-8H,1H3,(H,16,18)/b17-9+ |
| InChIKey | ZMEIUSLAHMLILY-RQZCQDPDSA-N |
| SMILES | CC(=NNC1=NC2=CC=CC=C2S1)C3=NC=NC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
