For research use only. Not for therapeutic Use.
Antioxidant agent-1（Cat No.:I045181）is a potent small molecule designed to neutralize reactive oxygen species (ROS) and reduce oxidative stress, thereby protecting cells and tissues from oxidative damage. By scavenging free radicals and stabilizing redox balance, it helps prevent lipid peroxidation, protein oxidation, and DNA damage linked to aging, inflammation, and degenerative diseases. Antioxidant agent-1 is a valuable research tool for studying oxidative stress–related pathways in conditions such as neurodegeneration, cardiovascular disorders, and metabolic syndromes. Its high stability and efficacy make it promising for therapeutic development targeting ROS-driven pathologies.
| CAS Number | 136068-43-4 |
| Synonyms | (E)-3-(3,4-dihydroxyphenyl)-1-phenylprop-2-en-1-one |
| Molecular Formula | C15H12O3 |
| Purity | ≥95% |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-1-phenylprop-2-en-1-one |
| InChI | InChI=1S/C15H12O3/c16-13(12-4-2-1-3-5-12)8-6-11-7-9-14(17)15(18)10-11/h1-10,17-18H/b8-6+ |
| InChIKey | HHKVOYUYPYZFHJ-SOFGYWHQSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C=C/C2=CC(=C(C=C2)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
