For research use only. Not for therapeutic Use.
Antimalarial agent 14（Cat No.:I043480）is an investigational compound being studied for its potential to treat malaria, a parasitic infection caused by Plasmodium species. It is designed to target specific stages of the parasite’s lifecycle, inhibiting its ability to proliferate and spread within the host. By disrupting key biological processes in the parasite, Antimalarial agent 14 may help reduce the severity of the infection and improve treatment outcomes. Ongoing research is focused on evaluating its efficacy, safety, and potential advantages over existing antimalarial treatments, especially in areas with drug-resistant strains of malaria.
| CAS Number | 1150-59-0 |
| Synonyms | 4-hydroxy-3-phenylnaphthalene-1,2-dione |
| Molecular Formula | C16H10O3 |
| Purity | ≥95% |
| IUPAC Name | 4-hydroxy-3-phenylnaphthalene-1,2-dione |
| InChI | InChI=1S/C16H10O3/c17-14-11-8-4-5-9-12(11)15(18)16(19)13(14)10-6-2-1-3-7-10/h1-9,17H |
| InChIKey | HCKUADBGJIXWTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3C(=O)C2=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
