For research use only. Not for therapeutic Use.
Anticancer Agent 9（Cat No.:I045034）is a synthetic small molecule designed to exhibit potent anticancer activity through targeted disruption of cellular signaling pathways or DNA replication mechanisms. While specific structural details may vary depending on context or publication, compounds labeled as “Agent 9” often function as kinase inhibitors, DNA intercalators, or apoptosis inducers in cancer research. It is commonly tested in preclinical models to evaluate its cytotoxicity against various tumor cell lines. Anticancer Agent 9 serves as a valuable probe in identifying novel therapeutic strategies and understanding cancer cell resistance mechanisms.
| CAS Number | 592542-61-5 |
| Synonyms | methyl 2-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]anilino]acetate |
| Molecular Formula | C22H27NO8S |
| Purity | ≥95% |
| IUPAC Name | methyl 2-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]anilino]acetate |
| InChI | InChI=1S/C22H27NO8S/c1-27-16-11-20(29-3)17(21(12-16)30-4)8-9-32(25,26)14-15-6-7-19(28-2)18(10-15)23-13-22(24)31-5/h6-12,23H,13-14H2,1-5H3/b9-8+ |
| InChIKey | XQGFPRPZKFBYNA-CMDGGOBGSA-N |
| SMILES | COC1=C(C=C(C=C1)CS(=O)(=O)/C=C/C2=C(C=C(C=C2OC)OC)OC)NCC(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
