For research use only. Not for therapeutic Use.
Antibacterial agent 27（Cat No.:I044088）is a synthetic small-molecule compound with broad-spectrum activity against Gram-positive and Gram-negative bacteria. It functions by disrupting bacterial cell wall synthesis, protein biosynthesis, or membrane integrity, depending on its structural class, leading to rapid bacterial growth inhibition or cell death. Antibacterial agent 27 is commonly used in preclinical research to investigate mechanisms of resistance, evaluate synergistic combinations, and develop new strategies against multi-drug-resistant (MDR) pathogens. It serves as a valuable tool for advancing antibiotic discovery, particularly in the context of emerging infectious diseases and antimicrobial resistance (AMR).
| CAS Number | 65795-51-9 |
| Synonyms | 4-[(1,3-diaminopyrrolo[3,2-f]quinazolin-7-yl)methyl]benzonitrile |
| Molecular Formula | C18H14N6 |
| Purity | ≥95% |
| IUPAC Name | 4-[(1,3-diaminopyrrolo[3,2-f]quinazolin-7-yl)methyl]benzonitrile |
| InChI | InChI=1S/C18H14N6/c19-9-11-1-3-12(4-2-11)10-24-8-7-13-15(24)6-5-14-16(13)17(20)23-18(21)22-14/h1-8H,10H2,(H4,20,21,22,23) |
| InChIKey | IZYHVTAYLHFZSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=CC3=C2C=CC4=C3C(=NC(=N4)N)N)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
