For research use only. Not for therapeutic Use.
Antibacterial agent 26（Cat No.:I044089）is a potent small-molecule compound with demonstrated efficacy against a range of bacterial pathogens, including drug-resistant strains. It exerts its antibacterial effect by targeting essential bacterial processes such as DNA replication, protein synthesis, or cell wall integrity, depending on its molecular mechanism. Antibacterial agent 26 is frequently employed in infectious disease research to evaluate novel antibacterial strategies, test synergistic drug combinations, and understand mechanisms of resistance. It is a valuable lead compound for developing next-generation antibiotics aimed at combating multidrug-resistant (MDR) and nosocomial infections.
| CAS Number | 75369-40-3 |
| Synonyms | methyl 4-[(1,3-diaminopyrrolo[3,2-f]quinazolin-7-yl)methyl]benzoate |
| Molecular Formula | C19H17N5O2 |
| Purity | ≥95% |
| IUPAC Name | methyl 4-[(1,3-diaminopyrrolo[3,2-f]quinazolin-7-yl)methyl]benzoate |
| InChI | InChI=1S/C19H17N5O2/c1-26-18(25)12-4-2-11(3-5-12)10-24-9-8-13-15(24)7-6-14-16(13)17(20)23-19(21)22-14/h2-9H,10H2,1H3,(H4,20,21,22,23) |
| InChIKey | BHSTYBXRXPZJCW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)CN2C=CC3=C2C=CC4=C3C(=NC(=N4)N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
