Anthracene-d10（Cat No.:R023971） is a high-purity deuterated compound, vital for advanced research in organic chemistry and materials science. This isotopically labeled version of anthracene, featuring ten deuterium atoms, is crucial for studies involving photophysics, photochemistry, and molecular spectroscopy. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of experiments in chemical reactions and environmental monitoring. With improved stability and consistency, Anthracene-d10 integrates seamlessly into various experimental setups, providing a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | R023971 |
| CAS Number | 1719-06-8 |
| Synonyms | Anthracin-d10; Green Oil-d10; NSC 7958-d10; Paranaphthalene-d10; Tetra Olive N2G-d10 |
| Molecular Formula | C14H10 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,10-decadeuterioanthracene |
| InChI | InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | MWPLVEDNUUSJAV-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C3C(=C(C(=C(C3=C(C2=C1[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
