For research use only. Not for therapeutic Use.
Anthracene-2,6-dicarboxylic acid(Cat No.:M117972) is a chemical compound with a molecular formula C16H10O4. It is derived from anthracene and contains two carboxylic acid functional groups located at the 2 and 6 positions of the anthracene ring. This compound is of interest in materials science and organic chemistry due to its potential use as a building block in the synthesis of various organic compounds and coordination polymers. Anthracene-2,6-dicarboxylic acid has also been studied for its fluorescence properties, which make it useful in the development of fluorescent sensors and materials.
| CAS Number | 138308-89-1 |
| Synonyms | ANTHRACENE-2,6-DICARBOXYLIC ACID |
| Molecular Formula | C16H10O4 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | anthracene-2,6-dicarboxylic acid |
| InChI | InChI=1S/C16H10O4/c17-15(18)11-3-1-9-5-14-8-12(16(19)20)4-2-10(14)6-13(9)7-11/h1-8H,(H,17,18)(H,19,20) |
| InChIKey | XAAYMWLCUICVSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC3=C(C=C21)C=C(C=C3)C(=O)O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |