For research use only. Not for therapeutic Use.
(-)-Anomalin（Cat No.:R008951）is a naturally occurring clerodane-type diterpenoid isolated from plants such as Lantana camara and other Lamiaceae family members. It exhibits notable bioactivities including anti-inflammatory, antimicrobial, and cytotoxic effects. (-)-Anomalin has been studied for its ability to inhibit tumor cell proliferation and modulate key signaling pathways involved in inflammation and oxidative stress. Its unique stereochemistry contributes to its biological specificity and potency. This compound is of interest in natural product chemistry and pharmacological research aimed at developing plant-derived therapeutic agents.
| CAS Number | 4970-26-7 |
| Synonyms | [(9R,10R)-8,8-dimethyl-9-[(Z)-2-methylbut-2-enoyl]oxy-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (Z)-2-methylbut-2-enoate |
| Molecular Formula | C24H26O7 |
| Purity | ≥95% |
| IUPAC Name | [(9R,10R)-8,8-dimethyl-9-[(Z)-2-methylbut-2-enoyl]oxy-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (Z)-2-methylbut-2-enoate |
| InChI | InChI=1S/C24H26O7/c1-7-13(3)22(26)29-20-18-16(11-9-15-10-12-17(25)28-19(15)18)31-24(5,6)21(20)30-23(27)14(4)8-2/h7-12,20-21H,1-6H3/b13-7-,14-8-/t20-,21-/m1/s1 |
| InChIKey | PNTWXEIQXBRCPS-IOWUNYDSSA-N |
| SMILES | C/C=C(/C)\C(=O)O[C@H]1[C@H](C(OC2=C1C3=C(C=C2)C=CC(=O)O3)(C)C)OC(=O)/C(=C\C)/C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
