For research use only. Not for therapeutic Use.
Anisole-piperazine-methanone-benzothiazole-p-methylpiperidine（Cat No.:I043989）is a complex organic compound featuring a multi-functional structure that combines aromatic, heterocyclic, and amine-based components. The molecule consists of an anisole (methoxybenzene) group, a piperazine ring, a methanone linkage, a benzothiazole unit, and a p-methylpiperidine moiety. This unique structure enables the compound to exhibit potential biological activity, particularly in areas such as drug design, molecular recognition, and receptor binding. It may be explored for its pharmacological properties, with applications in medicinal chemistry, particularly for developing therapeutic agents targeting specific diseases or conditions.
| CAS Number | 906258-69-3 |
| Synonyms | [4-(4-methoxyphenyl)piperazin-1-yl]-[2-(4-methylpiperidin-1-yl)-1,3-benzothiazol-6-yl]methanone |
| Molecular Formula | C25H30N4O2S |
| Purity | ≥95% |
| IUPAC Name | [4-(4-methoxyphenyl)piperazin-1-yl]-[2-(4-methylpiperidin-1-yl)-1,3-benzothiazol-6-yl]methanone |
| InChI | InChI=1S/C25H30N4O2S/c1-18-9-11-29(12-10-18)25-26-22-8-3-19(17-23(22)32-25)24(30)28-15-13-27(14-16-28)20-4-6-21(31-2)7-5-20/h3-8,17-18H,9-16H2,1-2H3 |
| InChIKey | CHQCVRDHOXMOLR-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)C2=NC3=C(S2)C=C(C=C3)C(=O)N4CCN(CC4)C5=CC=C(C=C5)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
