For research use only. Not for therapeutic Use.
| CAS Number | 64249-01-0 |
| Synonyms | ANILOGUARD |
| Molecular Formula | C13H19ClNO3PS2 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | N-(4-chlorophenyl)-2-dimethoxyphosphinothioylsulfanyl-N-propan-2-ylacetamide |
| InChI | InChI=1S/C13H19ClNO3PS2/c1-10(2)15(12-7-5-11(14)6-8-12)13(16)9-21-19(20,17-3)18-4/h5-8,10H,9H2,1-4H3 |
| InChIKey | NXQDBZGWYSEGFL-UHFFFAOYSA-N |
| SMILES | CC(C)N(C1=CC=C(C=C1)Cl)C(=O)CSP(=S)(OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |