For research use only. Not for therapeutic Use.
Angoline（Cat No.:I044883）is a naturally occurring benzophenanthridine alkaloid isolated from Zanthoxylum species and other medicinal plants. It features a polycyclic aromatic structure with nitrogen-containing heterocycles, contributing to its biological activity. Angoline exhibits a range of pharmacological properties, including anti-inflammatory, antimicrobial, and anticancer effects. It acts by modulating key cellular pathways such as apoptosis and NF-κB signaling. Due to its cytotoxic activity, angoline is being explored as a lead compound in anticancer drug development. Its traditional use and emerging pharmacological data highlight its potential in integrative and pharmaceutical medicine.
| CAS Number | 21080-31-9 |
| Synonyms | 1,2,13-trimethoxy-12-methyl-13H-[1,3]benzodioxolo[5,6-c]phenanthridine |
| Molecular Formula | C22H21NO5 |
| Purity | ≥95% |
| IUPAC Name | 1,2,13-trimethoxy-12-methyl-13H-[1,3]benzodioxolo[5,6-c]phenanthridine |
| InChI | InChI=1S/C22H21NO5/c1-23-20-14(6-5-12-9-17-18(10-15(12)20)28-11-27-17)13-7-8-16(24-2)21(25-3)19(13)22(23)26-4/h5-10,22H,11H2,1-4H3 |
| InChIKey | LVWAKZBZWYHYCJ-UHFFFAOYSA-N |
| SMILES | CN1C(C2=C(C=CC(=C2OC)OC)C3=C1C4=CC5=C(C=C4C=C3)OCO5)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
