For research use only. Not for therapeutic Use.
AN-12-H5 intermediate-3 (Cat No.: I040136) is a chemical compound used as a precursor in the synthesis of bioactive molecules, often in drug development. It serves as an important intermediate in the creation of compounds targeting various biological pathways, including inflammation, cancer, or metabolic disorders. The structure of AN-12-H5 intermediate-3 allows for further modifications to optimize its therapeutic properties. Its role in the synthetic pathway makes it a valuable component for developing novel treatments, especially for diseases where targeted molecular intervention is needed.
CAS Number | 851314-03-9 |
Synonyms | methyl 5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate |
Molecular Formula | C13H16BrNO4 |
Purity | ≥95% |
InChI | InChI=1S/C13H16BrNO4/c1-13(2,3)19-12(17)15-10-6-5-8(14)7-9(10)11(16)18-4/h5-7H,1-4H3,(H,15,17) |
InChIKey | IJEPSKGWQSWFTQ-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)Br)C(=O)OC |
Reference | [1]. AN-12-H5 shows no inhibitory effect on PI4KB activity and only moderate inhibitory effects on PI 3-kinase activity[1]. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |