For research use only. Not for therapeutic Use.
AMXI-5001 hydrochloride（Cat No.:I043994）is a chemical compound studied for its potential applications in biomedical research. It is a hydrochloride salt form of AMXI-5001, which may possess biological activity relevant to drug discovery. AMXI-5001 hydrochloride is typically investigated for its effects on specific molecular targets, such as enzymes or receptors involved in disease processes. Its precise mechanism of action and therapeutic potential are under exploration, with potential uses in areas like cancer treatment, inflammation modulation, or neurological disorders. As a research tool, it may assist in the development of targeted therapies for various diseases.
| Synonyms | ethyl N-[6-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl]carbamate;hydrochloride |
| Molecular Formula | C25H21ClFN5O3 |
| Purity | ≥95% |
| IUPAC Name | ethyl N-[6-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1H-benzimidazol-2-yl]carbamate;hydrochloride |
| InChI | InChI=1S/C25H20FN5O3.ClH/c1-2-34-25(33)29-24-27-20-10-8-15(13-22(20)28-24)18-11-14(7-9-19(18)26)12-21-16-5-3-4-6-17(16)23(32)31-30-21;/h3-11,13H,2,12H2,1H3,(H,31,32)(H2,27,28,29,33);1H |
| InChIKey | DCTVJMPYKWHEFD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1=NC2=C(N1)C=C(C=C2)C3=C(C=CC(=C3)CC4=NNC(=O)C5=CC=CC=C54)F.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
