For research use only. Not for therapeutic Use.
AMPK-IN-3(Cat No.:I042860)is a potent and selective inhibitor of AMP-activated protein kinase (AMPK), an essential regulator of cellular energy homeostasis. By inhibiting AMPK activity, AMPK-IN-3 disrupts the normal balance of energy metabolism, which can impact processes such as glucose uptake, lipid synthesis, and autophagy. This compound shows potential in addressing conditions linked to metabolic disorders, including type 2 diabetes, obesity, and cancer. Additionally, AMPK-IN-3’s ability to influence cellular energy states makes it a promising candidate for further research in metabolic disease and cancer treatment.
| CAS Number | 2417674-27-0 |
| Synonyms | 5-[(Z)-[5-(3-amino-3-oxopropyl)-2-oxo-1H-indol-3-ylidene]methyl]-N-[2-(diethylamino)ethyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| Molecular Formula | C25H33N5O3 |
| Purity | ≥95% |
| IUPAC Name | 5-[(Z)-[5-(3-amino-3-oxopropyl)-2-oxo-1H-indol-3-ylidene]methyl]-N-[2-(diethylamino)ethyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| InChI | InChI=1S/C25H33N5O3/c1-5-30(6-2)12-11-27-25(33)23-15(3)21(28-16(23)4)14-19-18-13-17(8-10-22(26)31)7-9-20(18)29-24(19)32/h7,9,13-14,28H,5-6,8,10-12H2,1-4H3,(H2,26,31)(H,27,33)(H,29,32)/b19-14- |
| InChIKey | IQUHNNUWFFXNMM-RGEXLXHISA-N |
| SMILES | CCN(CC)CCNC(=O)C1=C(NC(=C1C)/C=C\2/C3=C(C=CC(=C3)CCC(=O)N)NC2=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |