For research use only. Not for therapeutic Use.
AMPK Activator 2 hydrochloride (CAT: I040336) is a fluorine-containing proguanil derivative that functions as a potent activator of the AMP-activated protein kinase (AMPK) signaling pathway. It concurrently downregulates the mTOR/4EBP1/p70S6K axis, thereby modulating key regulators of cellular growth and metabolism. This compound exhibits significant antiproliferative and antimigratory effects against various human cancer cell lines, including UMUC3, T24, and A549. Its dual regulation of metabolic and growth signaling makes it a valuable tool for studying cancer metabolism, energy stress responses, and potential therapeutic interventions in oncology.
| Synonyms | (1E)-1-[amino-[4-(trifluoromethyl)anilino]methylidene]-2-(2-methylpropyl)guanidine;hydrochloride |
| Molecular Formula | C13H19ClF3N5 |
| Purity | ≥95% |
| IUPAC Name | (1E)-1-[amino-[4-(trifluoromethyl)anilino]methylidene]-2-(2-methylpropyl)guanidine;hydrochloride |
| InChI | InChI=1S/C13H18F3N5.ClH/c1-8(2)7-19-11(17)21-12(18)20-10-5-3-9(4-6-10)13(14,15)16;/h3-6,8H,7H2,1-2H3,(H5,17,18,19,20,21);1H |
| InChIKey | XNTYRKPRMWJMAZ-UHFFFAOYSA-N |
| SMILES | CC(C)CN=C(N)N=C(N)NC1=CC=C(C=C1)C(F)(F)F.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
