For research use only. Not for therapeutic Use.
Amoxapine(Cat No.:A000936)is a tricyclic antidepressant (TCA) used to treat major depressive disorder and certain anxiety-related conditions. It works by inhibiting the reuptake of serotonin and norepinephrine, thereby increasing their levels in the brain, which helps improve mood and alleviate depressive symptoms. Additionally, amoxapine has dopaminergic activity, which may contribute to its effects on mood and behavior. While effective, amoxapine is associated with potential side effects such as sedation, weight gain, and cardiovascular issues. It is generally prescribed when other antidepressants are ineffective or not well tolerated by the patient.
CAS Number | 14028-44-5 |
Synonyms | 14028-44-5; Asendin; Demolox; Moxadil; Amoxan |
Molecular Formula | C17H16ClN3O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 8-chloro-6-piperazin-1-ylbenzo[b][1,4]benzoxazepine |
InChI | InChI=1S/C17H16ClN3O/c18-12-5-6-15-13(11-12)17(21-9-7-19-8-10-21)20-14-3-1-2-4-16(14)22-15/h1-6,11,19H,7-10H2 |
InChIKey | QWGDMFLQWFTERH-UHFFFAOYSA-N |
SMILES | C1CN(CCN1)C2=NC3=CC=CC=C3OC4=C2C=C(C=C4)Cl |
Reference |
|
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |