For research use only. Not for therapeutic Use.
Ammonium hexachlororuthenate(IV) (Cat No.: M081419), with the formula (NH₄)₂[RuCl₆], is a coordination compound consisting of a ruthenium(IV) center surrounded by six chloride ligands in an octahedral geometry, balanced by two ammonium cations. This dark red to brown crystalline solid is primarily used as a precursor in the synthesis of other ruthenium complexes and catalysts. It plays a significant role in organometallic chemistry and materials science, particularly in redox studies, electronic materials, and homogeneous catalysis involving transition metal halide complexes.
CAS Number | 18746-63-9 |
Molecular Formula | Cl6H8N2Ru |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | diazanium;hexachlororuthenium(2-) |
InChI | InChI=1S/6ClH.2H3N.Ru/h6*1H;2*1H3;/q;;;;;;;;+4/p-4 |
InChIKey | DHTSBQSPUBOKKI-UHFFFAOYSA-J |
SMILES | [NH4+].[NH4+].Cl[Ru-2](Cl)(Cl)(Cl)(Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |