For research use only. Not for therapeutic Use.
Amlodipine-d4 maleate（Cat No.:I045027）is a deuterium-labeled derivative of amlodipine, containing four deuterium atoms for enhanced stability and precise quantification in mass spectrometry. As a calcium channel blocker, it inhibits L-type calcium channels, promoting vasodilation and reducing blood pressure and myocardial oxygen demand. The maleate salt improves solubility and formulation compatibility for research use. Amlodipine-d4 maleate is widely used in pharmacokinetic, bioequivalence, and metabolic studies, allowing differentiation from the native drug. It is valuable in drug development and analytical assays, ensuring accurate monitoring without altering pharmacological activity.
| CAS Number | 2714486-25-4 |
| Synonyms | (Z)-but-2-enedioic acid;3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chloro-3,4,5,6-tetradeuteriophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Formula | C24H25D4ClN2O9 |
| Purity | ≥95% |
| IUPAC Name | (Z)-but-2-enedioic acid;3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chloro-3,4,5,6-tetradeuteriophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChI | InChI=1S/C20H25ClN2O5.C4H4O4/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;5-3(6)1-2-4(7)8/h5-8,17,23H,4,9-11,22H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/i5D,6D,7D,8D; |
| InChIKey | TZNOWAJJWCGILX-XDWXEZNJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2C(=C(NC(=C2C(=O)OCC)COCCN)C)C(=O)OC)Cl)[2H])[2H].C(=C\C(=O)O)\C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
