For research use only. Not for therapeutic Use.
Amlodipine besylate（Cat No.:A000944）is a calcium channel blocker used primarily to treat high blood pressure and angina (chest pain). It works by inhibiting the influx of calcium ions into vascular smooth muscle and cardiac muscle, resulting in vasodilation and reduced blood pressure. Amlodipine besylate is the besylate salt form of amlodipine, enhancing its stability and solubility. It is taken orally, usually once daily, and is well tolerated with a long half-life that allows for sustained blood pressure control. Common side effects include swelling, dizziness, and flushing. It is widely prescribed in cardiovascular therapy.
| CAS Number | 111470-99-6 |
| Synonyms | NA |
| Molecular Formula | C20H25ClN2O5.C6H6O3S |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | >26.1mg/mL in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | benzenesulfonic acid;3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChI | InChI=1S/C20H25ClN2O5.C6H6O3S/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;7-10(8,9)6-4-2-1-3-5-6/h5-8,17,23H,4,9-11,22H2,1-3H3;1-5H,(H,7,8,9) |
| InChIKey | ZPBWCRDSRKPIDG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2Cl)C(=O)OC)C)COCCN.C1=CC=C(C=C1)S(=O)(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
