For research use only. Not for therapeutic Use.
Aminopropyl-terminated polydimethylsiloxane (Cat No.: M005047) is a functionalized silicone polymer with aminopropyl groups at both chain ends. It combines the flexibility, thermal stability, and hydrophobicity of PDMS with the reactivity of terminal amine groups. These amines enable covalent bonding to various substrates, making it valuable in surface modification, adhesion promotion, and crosslinking reactions. It is widely used in coatings, sealants, biomedical devices, and as an intermediate in advanced material synthesis. Its tunable molecular weight allows customization for specific industrial or research applications.
| CAS Number | 106214-84-0 |
| Molecular Formula | C12H34N2O2Si3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-[[[3-aminopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propan-1-amine |
| InChI | InChI=1S/C12H34N2O2Si3/c1-17(2,11-7-9-13)15-19(5,6)16-18(3,4)12-8-10-14/h7-14H2,1-6H3 |
| InChIKey | ZWRBLCDTKAWRHT-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCCN)O[Si](C)(C)O[Si](C)(C)CCCN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
