For research use only. Not for therapeutic Use.
Amino-Tri-(carboxyethoxymethyl)-methane hydrochloride(Cat No.:I042962)is a synthetic compound used primarily in biochemical and pharmaceutical research. It functions as a buffering agent, providing stability to solutions by maintaining a constant pH level in various experimental settings. The compound is often employed in cell culture media, protein purification processes, and enzyme assays due to its ability to resist pH fluctuations that could otherwise affect the results. Additionally, it has potential applications in drug formulation, helping to stabilize active pharmaceutical ingredients. While its primary use is in laboratory settings, further research may expand its applications in medicine and therapeutics.
CAS Number | 1416771-72-6 |
Synonyms | 3-[2-amino-3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)propoxy]propanoic acid;hydrochloride |
Molecular Formula | C13H24ClNO9 |
Purity | ≥95% |
IUPAC Name | 3-[2-amino-3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)propoxy]propanoic acid;hydrochloride |
InChI | InChI=1S/C13H23NO9.ClH/c14-13(7-21-4-1-10(15)16,8-22-5-2-11(17)18)9-23-6-3-12(19)20;/h1-9,14H2,(H,15,16)(H,17,18)(H,19,20);1H |
InChIKey | ACGZZBXQNDTJIA-UHFFFAOYSA-N |
SMILES | C(COCC(COCCC(=O)O)(COCCC(=O)O)N)C(=O)O.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |