Amifampridine (Cat No.: I004036) is a pyridine organic compound, which can be used as a pharmaceutical intermediate and an organic synthesis intermediate, mainly used in laboratory research and development processes and chemical production processes. Additionally, treatment of patients with LEMS includes oncology therapy (if applicable) and symptom management. AChE inhibitors usually do not produce significant improvement. Amifampridine has been used to treat LEMS.
| Catalog Number | I004036 |
| CAS Number | 54-96-6 |
| Molecular Formula | C5H7N3 |
| Purity | 95% |
| Target | Others |
| Solubility | DMSO: ≥ 38 mg/mL |
| Storage | Store at -20C |
| IUPAC Name | pyridine-3,4-diamine |
| InChI | InChI=1S/C5H7N3/c6-4-1-2-8-3-5(4)7/h1-3H,7H2,(H2,6,8) |
| InChIKey | OYTKINVCDFNREN-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1N)N |
| Reference | <p style=/line-height:25px/> |
