For research use only. Not for therapeutic Use.
ALV1（Cat No.:I043571）is a chemical compound or molecular entity under investigation, often in the context of drug development or scientific research. While specific details about ALV1 may vary depending on the research focus, compounds with such names are typically studied for their biological activity, such as enzyme inhibition, receptor modulation, or targeting specific disease pathways. ALV1 could potentially have applications in areas like cancer treatment, infectious diseases, or metabolic disorders. Ongoing research aims to evaluate its efficacy, safety, and therapeutic potential in preclinical or clinical settings, offering new possibilities in drug discovery.
| CAS Number | 2438124-79-7 |
| Synonyms | N-(3-chloro-4-methylphenyl)-3-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]propanamide |
| Molecular Formula | C25H23ClN4O5 |
| Purity | ≥95% |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-3-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]propanamide |
| InChI | InChI=1S/C25H23ClN4O5/c1-14-5-7-17(12-18(14)26)28-21(31)9-6-15-3-2-4-16(11-15)27-19-13-23(33)30(25(19)35)20-8-10-22(32)29-24(20)34/h2-5,7,11-13,20,27H,6,8-10H2,1H3,(H,28,31)(H,29,32,34) |
| InChIKey | YDYSAFPHVGVORZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)CCC2=CC(=CC=C2)NC3=CC(=O)N(C3=O)C4CCC(=O)NC4=O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
