For research use only. Not for therapeutic Use.
Alpibectir（Cat No.:I043422）is an investigational drug being studied for its potential therapeutic applications, particularly in the treatment of viral infections. It is a compound designed to target specific viral enzymes or proteins involved in the replication of viruses. By inhibiting these key components, Alpibectir may help reduce viral load and prevent the spread of the infection within the body. Research is ongoing to evaluate its efficacy and safety, with a focus on its use against diseases such as hepatitis or other viral conditions, offering a potential alternative to current antiviral therapies.
| CAS Number | 2285440-39-1 |
| Synonyms | 4,4,4-trifluoro-1-[3-(trifluoromethyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-8-yl]butan-1-one |
| Molecular Formula | C12H14F6N2O2 |
| Purity | ≥95% |
| IUPAC Name | 4,4,4-trifluoro-1-[3-(trifluoromethyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-8-yl]butan-1-one |
| InChI | InChI=1S/C12H14F6N2O2/c13-11(14,15)2-1-9(21)20-5-3-10(4-6-20)7-8(19-22-10)12(16,17)18/h1-7H2 |
| InChIKey | ZEAVKHMQTZBUND-UHFFFAOYSA-N |
| SMILES | C1CN(CCC12CC(=NO2)C(F)(F)F)C(=O)CCC(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
