For research use only. Not for therapeutic Use.
α-Vinylbenzyl alcohol（Cat No.:L043878）is an aromatic alcohol featuring a benzene ring substituted with both a hydroxymethyl group and a vinyl group at the benzylic (α) position. This bifunctional molecule is valuable in polymer chemistry and organic synthesis, serving as a monomer or reactive intermediate. The hydroxyl group enables esterification or etherification, while the vinyl group allows for radical polymerization or cross-linking. Its dual reactivity supports the synthesis of functional polymers, resins, and surface-modified materials. α-Vinylbenzyl alcohol is particularly useful in applications requiring site-specific functionalization or tailored polymer architectures.
| CAS Number | 4393-06-0 |
| Molecular Formula | C9H10O |
| Purity | ≥95% |
| IUPAC Name | 1-phenylprop-2-en-1-ol |
| InChI | InChI=1S/C9H10O/c1-2-9(10)8-6-4-3-5-7-8/h2-7,9-10H,1H2 |
| InChIKey | MHHJQVRGRPHIMR-UHFFFAOYSA-N |
| SMILES | C=CC(C1=CC=CC=C1)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
