For research use only. Not for therapeutic Use.
Alpha-naphthyl methacrylate(Cat No.:M076901) is a chemical compound derived from methacrylic acid and alpha-naphthol. It belongs to the class of methacrylate esters, characterized by the presence of a methacrylate group (CH2=C(CH3)COO-) linked to a naphthyl moiety. This compound is utilized in polymer chemistry as a monomer for the synthesis of polymers and copolymers through free-radical polymerization processes. Its incorporation into polymer matrices can impart specific properties, such as optical clarity, thermal stability, and chemical resistance, making it valuable in the production of coatings, adhesives, and specialty materials for various industrial and research applications.
CAS Number | 19102-44-4 |
Molecular Formula | C14H12O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | naphthalen-1-yl 2-methylprop-2-enoate |
InChI | InChI=1S/C14H12O2/c1-10(2)14(15)16-13-9-5-7-11-6-3-4-8-12(11)13/h3-9H,1H2,2H3 |
InChIKey | HVYCQBKSRWZZGX-UHFFFAOYSA-N |
SMILES | CC(=C)C(=O)OC1=CC=CC2=CC=CC=C21 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |