For research use only. Not for therapeutic Use.
Aloe emodin (CAT: I003695) is a natural anthraquinone compound found in various species of plants, including Aloe vera. It possesses a range of pharmacological activities, including anti-inflammatory, antioxidant, anticancer, and antimicrobial properties. Aloe emodin has been studied for its potential therapeutic applications in various diseases, such as cancer, inflammation-related disorders, diabetes, and microbial infections. It exhibits anticancer effects by inducing apoptosis, inhibiting cell proliferation, and interfering with various signaling pathways involved in tumor growth and metastasis. Additionally, aloe emodin has shown promising results in preclinical studies for its anti-inflammatory effects and its ability to modulate oxidative stress.
| CAS Number | 481-72-1 |
| Synonyms | 3-Hydroxymethylchrysazine;NSC 38628;Rhabarberone |
| Molecular Formula | C15H10O5 |
| Purity | ≥95% |
| Target | Anti-infection |
| Solubility | DMSO: 50 mg/mL |
| Storage | store at -20℃ |
| IUPAC Name | 1,8-dihydroxy-3-(hydroxymethyl)anthracene-9,10-dione |
| InChI | InChI=1S/C15H10O5/c16-6-7-4-9-13(11(18)5-7)15(20)12-8(14(9)19)2-1-3-10(12)17/h1-5,16-18H,6H2 |
| InChIKey | YDQWDHRMZQUTBA-UHFFFAOYSA-N |
| SMILES | O=C1C2=CC(CO)=CC(O)=C2C(C3=C1C=CC=C3O)=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |