For research use only. Not for therapeutic Use.
Aloe-emodin-8-O-β-D-glucopyranoside（Cat No.:R040939）is an anthraquinone glycoside primarily found in Aloe species and related medicinal plants. As the glycosylated form of aloe-emodin, it exhibits improved solubility and stability, enhancing its pharmacological potential. Research indicates it has notable antioxidant, anti-inflammatory, antimicrobial, and anticancer activities. It can scavenge free radicals, regulate inflammatory pathways, and induce apoptosis in tumor cells. Additionally, it demonstrates hepatoprotective and cytoprotective effects, supporting traditional uses of Aloe in herbal medicine. With its diverse bioactivities, aloe-emodin-8-O-β-D-glucopyranoside is considered a promising natural compound for therapeutic development and preventive health research.
| CAS Number | 33037-46-6 |
| Synonyms | 1-hydroxy-3-(hydroxymethyl)-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-9,10-dione |
| Molecular Formula | C21H20O10 |
| Purity | ≥95% |
| IUPAC Name | 1-hydroxy-3-(hydroxymethyl)-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-9,10-dione |
| InChI | InChI=1S/C21H20O10/c22-6-8-4-10-14(11(24)5-8)18(27)15-9(16(10)25)2-1-3-12(15)30-21-20(29)19(28)17(26)13(7-23)31-21/h1-5,13,17,19-24,26,28-29H,6-7H2/t13-,17-,19+,20-,21-/m1/s1 |
| InChIKey | KIZBWUUJNJEYCM-JNHRPPPUSA-N |
| SMILES | C1=CC2=C(C(=C1)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C(=O)C4=C(C2=O)C=C(C=C4O)CO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
