For research use only. Not for therapeutic Use.
Allyl Methyl Carbonate(Cat No.:L007087), is an organic compound used in chemical synthesis and polymerization processes. It consists of an allyl group (-CH2CH=CH2) and a carbonate ester functional group (-OC(O)OCH3). This compound is employed as a monomer in the production of polymers, specifically in the synthesis of allyl polymers and copolymers. These polymers find applications in various fields, including coatings, adhesives, and dental materials. Allyl methyl carbonate’s reactivity in radical polymerization processes allows for the creation of polymers with diverse properties, making it valuable in the development of specialized materials for industrial and commercial uses.
CAS Number | 35466-83-2 |
Molecular Formula | C5H8O3 |
Purity | ≥95% |
IUPAC Name | methyl prop-2-enyl carbonate |
InChI | InChI=1S/C5H8O3/c1-3-4-8-5(6)7-2/h3H,1,4H2,2H3 |
InChIKey | YHLVIDQQTOMBGN-UHFFFAOYSA-N |
SMILES | COC(=O)OCC=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |