For research use only. Not for therapeutic Use.
Allomatrine（Cat No.:I015306）is a naturally occurring quinolizidine alkaloid derived from plants of the Sophora genus. It exhibits diverse pharmacological activities, including notable anti-inflammatory, antioxidant, and anticancer effects. Studies have shown that allomatrine can modulate apoptosis, inhibit tumor cell proliferation, and protect against oxidative stress, highlighting its therapeutic potential. Additionally, it demonstrates antiviral and cardioprotective properties, supporting broader applications in disease research. With its distinctive structural features and bioactivity, allomatrine serves as a valuable compound for pharmacological studies and drug discovery in natural product chemistry.
| CAS Number | 641-39-4 |
| Synonyms | (1R,2R,9S,17R)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| Molecular Formula | C15H24N2O |
| Purity | ≥95% |
| IUPAC Name | (1R,2R,9S,17R)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| InChI | InChI=1S/C15H24N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15+/m0/s1 |
| InChIKey | ZSBXGIUJOOQZMP-KYEXWDHISA-N |
| SMILES | C1C[C@@H]2[C@H]3CCCN4[C@@H]3[C@@H](CCC4)CN2C(=O)C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
