For research use only. Not for therapeutic Use.
Aliconazole(Cat No.:E000031)is an imidazole-class antifungal agent used primarily in topical formulations to treat fungal skin infections. It works by inhibiting the synthesis of ergosterol, an essential component of fungal cell membranes, leading to increased membrane permeability and cell death. Aliconazole exhibits broad-spectrum antifungal activity against dermatophytes, yeasts, and molds. Its efficacy, combined with low systemic absorption when applied topically, makes it a safe and effective option for conditions such as athlete’s foot, ringworm, and candidiasis. It is often preferred for its favorable skin tolerance and prolonged local action.
| CAS Number | 63824-12-4 |
| Molecular Formula | C18H13Cl3N2 |
| Purity | ≥95% |
| IUPAC Name | 1-[(Z)-2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-enyl]imidazole |
| InChI | InChI=1S/C18H13Cl3N2/c19-16-4-1-13(2-5-16)15(11-23-8-7-22-12-23)9-14-3-6-17(20)10-18(14)21/h1-10,12H,11H2/b15-9+ |
| InChIKey | WNGFKUOERJDDIY-OQLLNIDSSA-N |
| SMILES | C1=CC(=CC=C1/C(=C/C2=C(C=C(C=C2)Cl)Cl)/CN3C=CN=C3)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |