For research use only. Not for therapeutic Use.
Ala-His（Cat No.:L002874）, also known as alanyl-histidine, is a dipeptide composed of the amino acids alanine and histidine linked by a peptide bond. Alanine is a small, nonpolar amino acid, while histidine contains an imidazole side chain that can participate in acid-base chemistry and metal binding. This dipeptide is of interest in biochemical and physiological studies due to its buffering capacity and potential antioxidant activity. Ala-His can serve as a model compound for studying peptide behavior, enzymatic hydrolysis, and metal coordination, especially in systems mimicking enzyme active sites or peptide-based therapeutics.
| CAS Number | 3253-17-6 |
| Molecular Formula | C9H14N4O3 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| InChI | InChI=1S/C9H14N4O3/c1-5(10)8(14)13-7(9(15)16)2-6-3-11-4-12-6/h3-5,7H,2,10H2,1H3,(H,11,12)(H,13,14)(H,15,16)/t5-,7-/m0/s1 |
| InChIKey | XZWXFWBHYRFLEF-FSPLSTOPSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC1=CN=CN1)C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
