For research use only. Not for therapeutic Use.
AJS1669 free acid（Cat No.:I021654）is a selective agonist of peroxisome proliferator-activated receptor delta (PPARδ), a nuclear receptor involved in regulating lipid metabolism, glucose homeostasis, and energy expenditure. This compound has been investigated for its potential in treating metabolic disorders such as type 2 diabetes, obesity, and dyslipidemia. By activating PPARδ, AJS1669 promotes fatty acid oxidation and improves insulin sensitivity without the weight gain often associated with other PPAR agonists. The free acid form enhances its pharmacokinetic properties, making it a valuable candidate in metabolic disease research and therapeutic development.
| CAS Number | 1853130-05-8 |
| Synonyms | 2-[[5-[[4-(4,5-difluoro-2-methylsulfanylphenyl)phenoxy]methyl]furan-2-carbonyl]-(furan-2-ylmethyl)amino]acetic acid |
| Molecular Formula | C26H21F2NO6S |
| Purity | ≥95% |
| IUPAC Name | 2-[[5-[[4-(4,5-difluoro-2-methylsulfanylphenyl)phenoxy]methyl]furan-2-carbonyl]-(furan-2-ylmethyl)amino]acetic acid |
| InChI | InChI=1S/C26H21F2NO6S/c1-36-24-12-22(28)21(27)11-20(24)16-4-6-17(7-5-16)34-15-19-8-9-23(35-19)26(32)29(14-25(30)31)13-18-3-2-10-33-18/h2-12H,13-15H2,1H3,(H,30,31) |
| InChIKey | IQZYODALPHIPRX-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=C(C=C1C2=CC=C(C=C2)OCC3=CC=C(O3)C(=O)N(CC4=CC=CO4)CC(=O)O)F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
