For research use only. Not for therapeutic Use.
AhR Agonist 2（Cat No.:I044051）is a selective small-molecule activator of the aryl hydrocarbon receptor (AhR), a ligand-activated transcription factor involved in xenobiotic metabolism, immune regulation, and cellular differentiation. Upon activation, AhR translocates to the nucleus and modulates the expression of target genes, including cytochrome P450 enzymes. AhR Agonist 2 is particularly useful in studying immune tolerance, mucosal immunity, and the impact of environmental or dietary ligands on cellular signaling. It supports research into autoimmune diseases, cancer immunology, and toxicology by enabling controlled activation of AhR signaling pathways in diverse biological contexts.
| CAS Number | 2975270-19-8 |
| Synonyms | 6-bromo-2-(4-bromophenyl)-[1,2,4]triazolo[1,5-a]pyridine |
| Molecular Formula | C12H7Br2N3 |
| Purity | ≥95% |
| IUPAC Name | 6-bromo-2-(4-bromophenyl)-[1,2,4]triazolo[1,5-a]pyridine |
| InChI | InChI=1S/C12H7Br2N3/c13-9-3-1-8(2-4-9)12-15-11-6-5-10(14)7-17(11)16-12/h1-7H |
| InChIKey | METAKUVFAGUKGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN3C=C(C=CC3=N2)Br)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
