For research use only. Not for therapeutic Use.
AGX51（Cat No.:I017942）is a small-molecule inhibitor that targets inhibitor of DNA-binding (Id) proteins, a family of transcriptional regulators implicated in cancer progression. By promoting Id protein degradation, AGX51 disrupts Id-mediated transcriptional control, leading to impaired tumor cell proliferation, reduced angiogenesis, and induction of apoptosis. Preclinical studies have shown potent antitumor effects in various cancers, including breast and pancreatic models. Its mechanism highlights Id proteins as promising therapeutic targets. AGX51 serves as both a valuable research tool and a potential lead compound for cancer drug development.
| CAS Number | 330834-54-3 |
| Synonyms | N-[3-(1,3-benzodioxol-5-yl)-3-(2-methoxyphenyl)propyl]-N-benzylpropanamide |
| Molecular Formula | C27H29NO4 |
| Purity | ≥95% |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-yl)-3-(2-methoxyphenyl)propyl]-N-benzylpropanamide |
| InChI | InChI=1S/C27H29NO4/c1-3-27(29)28(18-20-9-5-4-6-10-20)16-15-22(23-11-7-8-12-24(23)30-2)21-13-14-25-26(17-21)32-19-31-25/h4-14,17,22H,3,15-16,18-19H2,1-2H3 |
| InChIKey | SRADCMOCDMFMPS-UHFFFAOYSA-N |
| SMILES | CCC(=O)N(CCC(C1=CC2=C(C=C1)OCO2)C3=CC=CC=C3OC)CC4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
