For research use only. Not for therapeutic Use.
Agomelatin-d3(Cat No.:S000305) is a deuterated form of agomelatin, where three hydrogen atoms are replaced with deuterium. Agomelatin is an antidepressant that works by modulating melatonin receptors, which helps regulate circadian rhythms and mood. The introduction of deuterium atoms increases the stability of agomelatin, enabling more accurate pharmacokinetic and metabolic studies. These enhancements facilitate a deeper understanding of how agomelatin is processed in the body, which can lead to improved treatment strategies for depression, better management of dosing schedules, and potentially fewer side effects, thus improving overall patient care in mental health.
| CAS Number | 1079389-38-0 |
| Molecular Formula | C15H14D3NO2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| IUPAC Name | 2,2,2-trideuterio-N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide |
| InChI | InChI=1S/C15H17NO2/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13/h3-7,10H,8-9H2,1-2H3,(H,16,17)/i1D3 |
| InChIKey | YJYPHIXNFHFHND-FIBGUPNXSA-N |
| SMILES | CC(=O)NCCC1=CC=CC2=C1C=C(C=C2)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |