Agigenin - CAS 55332-76-8

Agigenin(CAT: R021510) is a natural compound known for its potential biological activities, particularly in the field of phytochemistry and traditional medicine. It is a steroidal saponin found in various plants and has been investigated for its pharmacological properties. Agigenin is known for its potential anti-inflammatory, antioxidant, and immunomodulatory effects. In traditional medicine, it has been used in some cultures for its purported health benefits.

Catalog Number: R021510

CAS Number: 55332-76-8

PubChem Substance ID:355143103

Molecular Formula: C27H44O5

Molecular Weight:448.644

Purity: ≥95%

* For research use only. Not for human or veterinary use.

Synonym

Synonyms(2R,2aS,2’R,4R,5R,5’R,6aR,6bS,8aS,8bR,9S,11aS,12aS,12bR)-5’,6a,8a,9-Tetramethyldocosahydrospiro[naphtho[2’,1’:4,5]indeno[2,1-b]furan-10,2’-pyran]-2,4,5-triol

Property

Molecular Formula: C27H44O5
Molecular Weight448.644
Purity≥95%
Storage-20°C

Computed Descriptor

InChIInChI=1S/C27H44O5/c1-14-5-8-27(31-13-14)15(2)24-23(32-27)11-18-16-9-20(28)19-10-21(29)22(30)12-26(19,4)17(16)6-7-25(18,24)3/h14-24,28-30H,5-13H2,1-4H3/t14-,15+,16-,17+,18+,19-,20-,21-,22-,23+,24+,25+,26-,27-/m1/s1
InChIKeyFYRLHXNMINIDCB-LEGLVIAUSA-N
SMILESCC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC(C6C5(CC(C(C6)O)O)C)O)C)C)OC1